C13H19ClFN3 — CID 139405266
1-(5-chloro-6-fluoro-4-methyl-2-pyridinyl)-2,4,6-trimethylpiperazine (PubChem CID 139405266) has the molecular formula C13H19ClFN3 and a molecular weight of 271.77 g/mol. Its IUPAC name is 1-(5-chloro-6-fluoro-4-methyl-2-pyridinyl)-2,4,6-trimethylpiperazine.
| Compound Name | 1-(5-chloro-6-fluoro-4-methyl-2-pyridinyl)-2,4,6-trimethylpiperazine |
|---|---|
| PubChem CID | 139405266 |
| Molecular Formula | C13H19ClFN3 |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 1-(5-chloro-6-fluoro-4-methyl-2-pyridinyl)-2,4,6-trimethylpiperazine |
| SMILES | Cc1cc(N2C(C)CN(C)CC2C)nc(F)c1Cl |
| InChI | InChI=1S/C13H19ClFN3/c1-8-5-11(16-13(15)12(8)14)18-9(2)6-17(4)7-10(18)3/h5,9-10H,6-7H2,1-4H3 |
| InChIKey | WHERWYRNQNRCFY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|