C13H18ClFN4O — CID 139405533
3-chloro-2-fluoro-6-[(2S)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-4-amine (PubChem CID 139405533) has the molecular formula C13H18ClFN4O and a molecular weight of 300.77 g/mol. Its IUPAC name is 3-chloro-2-fluoro-6-[(2S)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-4-amine.
| Compound Name | 3-chloro-2-fluoro-6-[(2S)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-4-amine |
|---|---|
| PubChem CID | 139405533 |
| Molecular Formula | C13H18ClFN4O |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 3-chloro-2-fluoro-6-[(2S)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-4-amine |
| SMILES | C[C@H]1CN(C2COC2)CCN1c1cc(N)c(Cl)c(F)n1 |
| InChI | InChI=1S/C13H18ClFN4O/c1-8-5-18(9-6-20-7-9)2-3-19(8)11-4-10(16)12(14)13(15)17-11/h4,8-9H,2-3,5-7H2,1H3,(H2,16,17)/t8-/m0/s1 |
| InChIKey | KXPPNGRYKVTXDG-QMMMGPOBSA-N |
| XLogP | 1.37 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|