C16H18F2N4OS — CID 167227037
11,13-difluoro-5,12,15-trimethyl-9-thia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one (PubChem CID 167227037) has the molecular formula C16H18F2N4OS and a molecular weight of 352.41 g/mol. Its IUPAC name is 11,13-difluoro-5,12,15-trimethyl-9-thia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one.
| Compound Name | 11,13-difluoro-5,12,15-trimethyl-9-thia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
|---|---|
| PubChem CID | 167227037 |
| Molecular Formula | C16H18F2N4OS |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 11,13-difluoro-5,12,15-trimethyl-9-thia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
| SMILES | Cc1c(F)c2c3c(nc(=O)n(C)c3c1F)N1CCN(C)CC1CS2 |
| InChI | InChI=1S/C16H18F2N4OS/c1-8-11(17)13-10-14(12(8)18)24-7-9-6-20(2)4-5-22(9)15(10)19-16(23)21(13)3/h9H,4-7H2,1-3H3 |
| InChIKey | QWLFUYALYGFOPG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |