C16H20ClIN6O — CID 167104763
12-chloro-16-iodo-5,10,13-trimethyl-2,5,10,14,16,18-hexazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11(19),12,14-tetraen-17-one (PubChem CID 167104763) has the molecular formula C16H20ClIN6O and a molecular weight of 474.73 g/mol. Its IUPAC name is 12-chloro-16-iodo-5,10,13-trimethyl-2,5,10,14,16,18-hexazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11(19),12,14-tetraen-17-one.
| Compound Name | 12-chloro-16-iodo-5,10,13-trimethyl-2,5,10,14,16,18-hexazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11(19),12,14-tetraen-17-one |
|---|---|
| PubChem CID | 167104763 |
| Molecular Formula | C16H20ClIN6O |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | 12-chloro-16-iodo-5,10,13-trimethyl-2,5,10,14,16,18-hexazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11(19),12,14-tetraen-17-one |
| SMILES | Cc1nc2c3c(nc(=O)n2I)N2CCN(C)CC2CCN(C)c3c1Cl |
| InChI | InChI=1S/C16H20ClIN6O/c1-9-12(17)13-11-14(20-16(25)24(18)15(11)19-9)23-7-6-21(2)8-10(23)4-5-22(13)3/h10H,4-8H2,1-3H3 |
| InChIKey | ZMXNMMHQDJCDRG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|