C15H17ClN4OS2 — CID 167226898
11-chloro-5,12,15-trimethyl-8,9-dithia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one (PubChem CID 167226898) has the molecular formula C15H17ClN4OS2 and a molecular weight of 368.92 g/mol. Its IUPAC name is 11-chloro-5,12,15-trimethyl-8,9-dithia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one.
| Compound Name | 11-chloro-5,12,15-trimethyl-8,9-dithia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
|---|---|
| PubChem CID | 167226898 |
| Molecular Formula | C15H17ClN4OS2 |
| Molecular Weight | 368.92 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 11-chloro-5,12,15-trimethyl-8,9-dithia-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
| SMILES | Cc1cc2c3c(nc(=O)n2C)N2CCN(C)CC2SSc3c1Cl |
| InChI | InChI=1S/C15H17ClN4OS2/c1-8-6-9-11-13(12(8)16)23-22-10-7-18(2)4-5-20(10)14(11)17-15(21)19(9)3/h6,10H,4-5,7H2,1-3H3 |
| InChIKey | UYSSCEFCIDNVMH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.92 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|