C14H13FI2N4O2 — CID 167105076
11-fluoro-5,15-diiodo-12-methyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one (PubChem CID 167105076) has the molecular formula C14H13FI2N4O2 and a molecular weight of 542.09 g/mol. Its IUPAC name is 11-fluoro-5,15-diiodo-12-methyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one.
| Compound Name | 11-fluoro-5,15-diiodo-12-methyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
|---|---|
| PubChem CID | 167105076 |
| Molecular Formula | C14H13FI2N4O2 |
| Molecular Weight | 542.09 g/mol |
| Exact Mass | 541.91 |
| IUPAC Name | 11-fluoro-5,15-diiodo-12-methyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
| SMILES | Cc1cc2c3c(nc(=O)n2I)N2CCN(I)CC2COc3c1F |
| InChI | InChI=1S/C14H13FI2N4O2/c1-7-4-9-10-12(11(7)15)23-6-8-5-19(16)2-3-20(8)13(10)18-14(22)21(9)17/h4,8H,2-3,5-6H2,1H3 |
| InChIKey | GVQJNMPDORHTBH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.09 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|