C19H22F4N4O — CID 167203954
9-(difluoromethyl)-14,16-difluoro-4,5,12,15-tetramethyl-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraen-11-one (PubChem CID 167203954) has the molecular formula C19H22F4N4O and a molecular weight of 398.40 g/mol. Its IUPAC name is 9-(difluoromethyl)-14,16-difluoro-4,5,12,15-tetramethyl-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraen-11-one.
| Compound Name | 9-(difluoromethyl)-14,16-difluoro-4,5,12,15-tetramethyl-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraen-11-one |
|---|---|
| PubChem CID | 167203954 |
| Molecular Formula | C19H22F4N4O |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 9-(difluoromethyl)-14,16-difluoro-4,5,12,15-tetramethyl-2,5,9,12-tetrazatetracyclo[8.8.0.02,7.013,18]octadeca-1(10),13,15,17-tetraen-11-one |
| SMILES | Cc1c(F)cc2c3c(c(=O)n(C)c2c1F)N(C(F)F)CC1CN(C)C(C)CN31 |
| InChI | InChI=1S/C19H22F4N4O/c1-9-6-26-11(7-24(9)3)8-27(19(22)23)17-16(26)12-5-13(20)10(2)14(21)15(12)25(4)18(17)28/h5,9,11,19H,6-8H2,1-4H3 |
| InChIKey | WGXQHHUPLNKTTN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 31.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|