C13H17NO — CID 167634223
4-methyl-3-methylidene-8-propan-2-yl-1,4-benzoxazine (PubChem CID 167634223) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 4-methyl-3-methylidene-8-propan-2-yl-1,4-benzoxazine.
| Compound Name | 4-methyl-3-methylidene-8-propan-2-yl-1,4-benzoxazine |
|---|---|
| PubChem CID | 167634223 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 4-methyl-3-methylidene-8-propan-2-yl-1,4-benzoxazine |
| SMILES | C=C1COc2c(C(C)C)cccc2N1C |
| InChI | InChI=1S/C13H17NO/c1-9(2)11-6-5-7-12-13(11)15-8-10(3)14(12)4/h5-7,9H,3,8H2,1-2,4H3 |
| InChIKey | BKWSQKBLSYIJLS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |