C20H18I2O6 — CID 167639033
(3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol (PubChem CID 167639033) has the molecular formula C20H18I2O6 and a molecular weight of 608.17 g/mol. Its IUPAC name is (3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol.
| Compound Name | (3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol |
|---|---|
| PubChem CID | 167639033 |
| Molecular Formula | C20H18I2O6 |
| Molecular Weight | 608.17 g/mol |
| Exact Mass | 607.92 |
| IUPAC Name | (3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol |
| SMILES | C=Cc1cc(O)c(I)c(O)c1.C=Cc1cc(OC(C)=O)c(I)c(OC(C)=O)c1 |
| InChI | InChI=1S/C12H11IO4.C8H7IO2/c1-4-9-5-10(16-7(2)14)12(13)11(6-9)17-8(3)15;1-2-5-3-6(10)8(9)7(11)4-5/h4-6H,1H2,2-3H3;2-4,10-11H,1H2 |
| InChIKey | OWZHOJNFRNIWCL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.17 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|