About (3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol
(3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol (PubChem CID 167639033) has the molecular formula C20H18I2O6
and a molecular weight of 608.17 g/mol. Its IUPAC name is (3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol.
Molecular Properties
| Compound Name | (3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol |
| PubChem CID | 167639033 |
| Molecular Formula | C20H18I2O6 |
| Molecular Weight | 608.17 g/mol |
| Exact Mass | 607.92 |
| IUPAC Name | (3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol |
| SMILES | C=Cc1cc(O)c(I)c(O)c1.C=Cc1cc(OC(C)=O)c(I)c(OC(C)=O)c1 |
| InChI | InChI=1S/C12H11IO4.C8H7IO2/c1-4-9-5-10(16-7(2)14)12(13)11(6-9)17-8(3)15;1-2-5-3-6(10)8(9)7(11)4-5/h4-6H,1H2,2-3H3;2-4,10-11H,1H2 |
| InChIKey | OWZHOJNFRNIWCL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 608.17 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol?
The IUPAC name of (3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol (CID 167639033) is (3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol.
What is the SMILES notation for (3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol?
The canonical SMILES for (3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol is C=Cc1cc(O)c(I)c(O)c1.C=Cc1cc(OC(C)=O)c(I)c(OC(C)=O)c1.
What is the InChIKey of (3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol?
The InChIKey is OWZHOJNFRNIWCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11IO4.C8H7IO2/c1-4-9-5-10(16-7(2)14)12(13)11(6-9)17-8(3)15;1-2-5-3-6(10)8(9)7(11)4-5/h4-6H,1H2,2-3H3;2-4,10-11H,1H2.
What are the key properties of (3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol?
(3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol has a molecular weight of 608.17 g/mol, XLogP of 5.13, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetyloxy-5-ethenyl-2-iodophenyl) acetate;5-ethenyl-2-iodobenzene-1,3-diol is sourced from PubChem (CID 167639033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).