C22H25NO5 — CID 16764425
5-[(4,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole (PubChem CID 16764425) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is 5-[(4,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-[(4,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 16764425 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 5-[(4,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole |
| SMILES | COc1cc(CC2CC(c3c(C)cc(C)cc3C)=NO2)c(OC)c2c1OCO2 |
| InChI | InChI=1S/C22H25NO5/c1-12-6-13(2)19(14(3)7-12)17-10-16(28-23-17)8-15-9-18(24-4)21-22(20(15)25-5)27-11-26-21/h6-7,9,16H,8,10-11H2,1-5H3 |
| InChIKey | NZDPJVKACGSTHO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |