C21H20FN3O6 — CID 26416801
(5R)-5-[(4,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-N-[(Z)-(4-fluorophenyl)methylideneamino]-4,5-dihydro-1,2-oxazole-3-carboxamide (PubChem CID 26416801) has the molecular formula C21H20FN3O6 and a molecular weight of 429.40 g/mol. Its IUPAC name is (5R)-5-[(4,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-N-[(Z)-(4-fluorophenyl)methylideneamino]-4,5-dihydro-1,2-oxazole-3-carboxamide.
| Compound Name | (5R)-5-[(4,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-N-[(Z)-(4-fluorophenyl)methylideneamino]-4,5-dihydro-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 26416801 |
| Molecular Formula | C21H20FN3O6 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | (5R)-5-[(4,7-dimethoxy-1,3-benzodioxol-5-yl)methyl]-N-[(Z)-(4-fluorophenyl)methylideneamino]-4,5-dihydro-1,2-oxazole-3-carboxamide |
| SMILES | COc1cc(C[C@@H]2CC(C(=O)N/N=C\c3ccc(F)cc3)=NO2)c(OC)c2c1OCO2 |
| InChI | InChI=1S/C21H20FN3O6/c1-27-17-8-13(18(28-2)20-19(17)29-11-30-20)7-15-9-16(25-31-15)21(26)24-23-10-12-3-5-14(22)6-4-12/h3-6,8,10,15H,7,9,11H2,1-2H3,(H,24,26)/b23-10-/t15-/m1/s1 |
| InChIKey | SPOHQHMFLTVWII-VEKQOBIDSA-N |
| XLogP | 2.41 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|