C24H25N3O8 — CID 16766950
ethyl 5-[[6-[(Z)-(benzoylhydrazinylidene)methyl]-4,7-dimethoxy-1,3-benzodioxol-5-yl]methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate (PubChem CID 16766950) has the molecular formula C24H25N3O8 and a molecular weight of 483.48 g/mol. Its IUPAC name is ethyl 5-[[6-[(Z)-(benzoylhydrazinylidene)methyl]-4,7-dimethoxy-1,3-benzodioxol-5-yl]methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-[[6-[(Z)-(benzoylhydrazinylidene)methyl]-4,7-dimethoxy-1,3-benzodioxol-5-yl]methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 16766950 |
| Molecular Formula | C24H25N3O8 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | ethyl 5-[[6-[(Z)-(benzoylhydrazinylidene)methyl]-4,7-dimethoxy-1,3-benzodioxol-5-yl]methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NOC(Cc2c(/C=N\NC(=O)c3ccccc3)c(OC)c3c(c2OC)OCO3)C1 |
| InChI | InChI=1S/C24H25N3O8/c1-4-32-24(29)18-11-15(35-27-18)10-16-17(12-25-26-23(28)14-8-6-5-7-9-14)20(31-3)22-21(19(16)30-2)33-13-34-22/h5-9,12,15H,4,10-11,13H2,1-3H3,(H,26,28)/b25-12- |
| InChIKey | IWQQVOAAYYHURP-ROTLSHHCSA-N |
| XLogP | 2.45 |
| TPSA | 126.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|