C24H24N4O10 — CID 98081872
ethyl (5S)-5-[[4,7-dimethoxy-6-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]-1,3-benzodioxol-5-yl]methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate (PubChem CID 98081872) has the molecular formula C24H24N4O10 and a molecular weight of 528.47 g/mol. Its IUPAC name is ethyl (5S)-5-[[4,7-dimethoxy-6-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]-1,3-benzodioxol-5-yl]methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl (5S)-5-[[4,7-dimethoxy-6-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]-1,3-benzodioxol-5-yl]methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 98081872 |
| Molecular Formula | C24H24N4O10 |
| Molecular Weight | 528.47 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | ethyl (5S)-5-[[4,7-dimethoxy-6-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]-1,3-benzodioxol-5-yl]methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NO[C@@H](Cc2c(/C=N/NC(=O)c3ccc([N+](=O)[O-])cc3)c(OC)c3c(c2OC)OCO3)C1 |
| InChI | InChI=1S/C24H24N4O10/c1-4-35-24(30)18-10-15(38-27-18)9-16-17(20(34-3)22-21(19(16)33-2)36-12-37-22)11-25-26-23(29)13-5-7-14(8-6-13)28(31)32/h5-8,11,15H,4,9-10,12H2,1-3H3,(H,26,29)/b25-11+/t15-/m0/s1 |
| InChIKey | AHTICCSELNINPN-OZKYXLFASA-N |
| XLogP | 2.36 |
| TPSA | 169.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|