C19H24N4O6 — CID 7082156
ethyl (5S)-5-[[[1-(4-nitrophenyl)piperidine-4-carbonyl]amino]methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate (PubChem CID 7082156) has the molecular formula C19H24N4O6 and a molecular weight of 404.42 g/mol. Its IUPAC name is ethyl (5S)-5-[[[1-(4-nitrophenyl)piperidine-4-carbonyl]amino]methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl (5S)-5-[[[1-(4-nitrophenyl)piperidine-4-carbonyl]amino]methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 7082156 |
| Molecular Formula | C19H24N4O6 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | ethyl (5S)-5-[[[1-(4-nitrophenyl)piperidine-4-carbonyl]amino]methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NO[C@H](CNC(=O)C2CCN(c3ccc([N+](=O)[O-])cc3)CC2)C1 |
| InChI | InChI=1S/C19H24N4O6/c1-2-28-19(25)17-11-16(29-21-17)12-20-18(24)13-7-9-22(10-8-13)14-3-5-15(6-4-14)23(26)27/h3-6,13,16H,2,7-12H2,1H3,(H,20,24)/t16-/m0/s1 |
| InChIKey | KJQUAJVRBBLVNR-INIZCTEOSA-N |
| XLogP | 1.64 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|