C19H23N3O7 — CID 7085084
ethyl (3aR,8aR)-1'-(4-nitrophenyl)spiro[3a,4,8,8a-tetrahydro-[1,3]dioxepino[5,6-d][1,2]oxazole-6,4'-piperidine]-3-carboxylate (PubChem CID 7085084) has the molecular formula C19H23N3O7 and a molecular weight of 405.41 g/mol. Its IUPAC name is ethyl (3aR,8aR)-1'-(4-nitrophenyl)spiro[3a,4,8,8a-tetrahydro-[1,3]dioxepino[5,6-d][1,2]oxazole-6,4'-piperidine]-3-carboxylate.
| Compound Name | ethyl (3aR,8aR)-1'-(4-nitrophenyl)spiro[3a,4,8,8a-tetrahydro-[1,3]dioxepino[5,6-d][1,2]oxazole-6,4'-piperidine]-3-carboxylate |
|---|---|
| PubChem CID | 7085084 |
| Molecular Formula | C19H23N3O7 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | ethyl (3aR,8aR)-1'-(4-nitrophenyl)spiro[3a,4,8,8a-tetrahydro-[1,3]dioxepino[5,6-d][1,2]oxazole-6,4'-piperidine]-3-carboxylate |
| SMILES | CCOC(=O)C1=NO[C@H]2COC3(CCN(c4ccc([N+](=O)[O-])cc4)CC3)OC[C@@H]12 |
| InChI | InChI=1S/C19H23N3O7/c1-2-26-18(23)17-15-11-27-19(28-12-16(15)29-20-17)7-9-21(10-8-19)13-3-5-14(6-4-13)22(24)25/h3-6,15-16H,2,7-12H2,1H3/t15-,16+/m1/s1 |
| InChIKey | GSYPMPNKZOJCDP-CVEARBPZSA-N |
| XLogP | 1.87 |
| TPSA | 112.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|