C19H20F3N5O7 — CID 40815506
N-[[(5S)-3-acetyl-4,5-dihydro-1,2-oxazol-5-yl]methyl]-1-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide (PubChem CID 40815506) has the molecular formula C19H20F3N5O7 and a molecular weight of 487.39 g/mol. Its IUPAC name is N-[[(5S)-3-acetyl-4,5-dihydro-1,2-oxazol-5-yl]methyl]-1-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide.
| Compound Name | N-[[(5S)-3-acetyl-4,5-dihydro-1,2-oxazol-5-yl]methyl]-1-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 40815506 |
| Molecular Formula | C19H20F3N5O7 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | N-[[(5S)-3-acetyl-4,5-dihydro-1,2-oxazol-5-yl]methyl]-1-[2,6-dinitro-4-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
| SMILES | CC(=O)C1=NO[C@H](CNC(=O)C2CCN(c3c([N+](=O)[O-])cc(C(F)(F)F)cc3[N+](=O)[O-])CC2)C1 |
| InChI | InChI=1S/C19H20F3N5O7/c1-10(28)14-8-13(34-24-14)9-23-18(29)11-2-4-25(5-3-11)17-15(26(30)31)6-12(19(20,21)22)7-16(17)27(32)33/h6-7,11,13H,2-5,8-9H2,1H3,(H,23,29)/t13-/m0/s1 |
| InChIKey | LUSWTDGRVZSZTE-ZDUSSCGKSA-N |
| XLogP | 2.59 |
| TPSA | 157.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|