C20H18FN3O5 — CID 26416744
(4R,5S)-N-[(Z)-(3-fluorophenyl)methylideneamino]-5-(7-methoxy-1,3-benzodioxol-5-yl)-4-methyl-4,5-dihydro-1,2-oxazole-3-carboxamide (PubChem CID 26416744) has the molecular formula C20H18FN3O5 and a molecular weight of 399.38 g/mol. Its IUPAC name is (4R,5S)-N-[(Z)-(3-fluorophenyl)methylideneamino]-5-(7-methoxy-1,3-benzodioxol-5-yl)-4-methyl-4,5-dihydro-1,2-oxazole-3-carboxamide.
| Compound Name | (4R,5S)-N-[(Z)-(3-fluorophenyl)methylideneamino]-5-(7-methoxy-1,3-benzodioxol-5-yl)-4-methyl-4,5-dihydro-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 26416744 |
| Molecular Formula | C20H18FN3O5 |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | (4R,5S)-N-[(Z)-(3-fluorophenyl)methylideneamino]-5-(7-methoxy-1,3-benzodioxol-5-yl)-4-methyl-4,5-dihydro-1,2-oxazole-3-carboxamide |
| SMILES | COc1cc([C@H]2ON=C(C(=O)N/N=C\c3cccc(F)c3)[C@H]2C)cc2c1OCO2 |
| InChI | InChI=1S/C20H18FN3O5/c1-11-17(20(25)23-22-9-12-4-3-5-14(21)6-12)24-29-18(11)13-7-15(26-2)19-16(8-13)27-10-28-19/h3-9,11,18H,10H2,1-2H3,(H,23,25)/b22-9-/t11-,18+/m1/s1 |
| InChIKey | FKAOOHCPBVJUHX-ZANOWTKSSA-N |
| XLogP | 2.78 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|