C40H47N9O5 — CID 167654430
3-[1,3-dioxo-2-(2-oxopiperidin-3-yl)isoindol-4-yl]-N-[2-[[4-[4-(3-phenylpyrazolo[3,4-d]pyrimidin-1-yl)cyclohexyl]piperazin-1-yl]methoxy]ethyl]propanamide (PubChem CID 167654430) has the molecular formula C40H47N9O5 and a molecular weight of 733.87 g/mol. Its IUPAC name is 3-[1,3-dioxo-2-(2-oxopiperidin-3-yl)isoindol-4-yl]-N-[2-[[4-[4-(3-phenylpyrazolo[3,4-d]pyrimidin-1-yl)cyclohexyl]piperazin-1-yl]methoxy]ethyl]propanamide.
| Compound Name | 3-[1,3-dioxo-2-(2-oxopiperidin-3-yl)isoindol-4-yl]-N-[2-[[4-[4-(3-phenylpyrazolo[3,4-d]pyrimidin-1-yl)cyclohexyl]piperazin-1-yl]methoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 167654430 |
| Molecular Formula | C40H47N9O5 |
| Molecular Weight | 733.87 g/mol |
| Exact Mass | 733.37 |
| IUPAC Name | 3-[1,3-dioxo-2-(2-oxopiperidin-3-yl)isoindol-4-yl]-N-[2-[[4-[4-(3-phenylpyrazolo[3,4-d]pyrimidin-1-yl)cyclohexyl]piperazin-1-yl]methoxy]ethyl]propanamide |
| SMILES | O=C(CCc1cccc2c1C(=O)N(C1CCCNC1=O)C2=O)NCCOCN1CCN(C2CCC(n3nc(-c4ccccc4)c4cncnc43)CC2)CC1 |
| InChI | InChI=1S/C40H47N9O5/c50-34(16-11-27-8-4-9-31-35(27)40(53)48(39(31)52)33-10-5-17-43-38(33)51)42-18-23-54-26-46-19-21-47(22-20-46)29-12-14-30(15-13-29)49-37-32(24-41-25-44-37)36(45-49)28-6-2-1-3-7-28/h1-4,6-9,24-25,29-30,33H,5,10-23,26H2,(H,42,50)(H,43,51) |
| InChIKey | UVENOPYNKWQGTI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 154.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.87 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|