C44H42N2O8 — CID 167655288
2-[(6,7-dimethoxyisoquinolin-1-yl)methyl]-4,5-dimethoxyaniline;5,7-dimethoxy-4-[3-(4-methylphenyl)phenyl]chromen-2-one (PubChem CID 167655288) has the molecular formula C44H42N2O8 and a molecular weight of 726.83 g/mol. Its IUPAC name is 2-[(6,7-dimethoxyisoquinolin-1-yl)methyl]-4,5-dimethoxyaniline;5,7-dimethoxy-4-[3-(4-methylphenyl)phenyl]chromen-2-one.
| Compound Name | 2-[(6,7-dimethoxyisoquinolin-1-yl)methyl]-4,5-dimethoxyaniline;5,7-dimethoxy-4-[3-(4-methylphenyl)phenyl]chromen-2-one |
|---|---|
| PubChem CID | 167655288 |
| Molecular Formula | C44H42N2O8 |
| Molecular Weight | 726.83 g/mol |
| Exact Mass | 726.29 |
| IUPAC Name | 2-[(6,7-dimethoxyisoquinolin-1-yl)methyl]-4,5-dimethoxyaniline;5,7-dimethoxy-4-[3-(4-methylphenyl)phenyl]chromen-2-one |
| SMILES | COc1cc(N)c(Cc2nccc3cc(OC)c(OC)cc23)cc1OC.COc1cc(OC)c2c(-c3cccc(-c4ccc(C)cc4)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H20O4.C20H22N2O4/c1-15-7-9-16(10-8-15)17-5-4-6-18(11-17)20-14-23(25)28-22-13-19(26-2)12-21(27-3)24(20)22;1-23-17-8-12-5-6-22-16(14(12)10-19(17)25-3)7-13-9-18(24-2)20(26-4)11-15(13)21/h4-14H,1-3H3;5-6,8-11H,7,21H2,1-4H3 |
| InChIKey | RDYWMJGARUODOH-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.83 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|