C34H35ClN8 — CID 167665453
2-chloro-6-(2,3-dihydro-1H-inden-4-ylamino)-4,5-dimethylpyridine-3-carbonitrile;6-N-(2,3-dihydro-1H-inden-4-yl)-4,5-dimethyl-2H-pyrazolo[3,4-b]pyridine-3,6-diamine (PubChem CID 167665453) has the molecular formula C34H35ClN8 and a molecular weight of 591.16 g/mol. Its IUPAC name is 2-chloro-6-(2,3-dihydro-1H-inden-4-ylamino)-4,5-dimethylpyridine-3-carbonitrile;6-N-(2,3-dihydro-1H-inden-4-yl)-4,5-dimethyl-2H-pyrazolo[3,4-b]pyridine-3,6-diamine.
| Compound Name | 2-chloro-6-(2,3-dihydro-1H-inden-4-ylamino)-4,5-dimethylpyridine-3-carbonitrile;6-N-(2,3-dihydro-1H-inden-4-yl)-4,5-dimethyl-2H-pyrazolo[3,4-b]pyridine-3,6-diamine |
|---|---|
| PubChem CID | 167665453 |
| Molecular Formula | C34H35ClN8 |
| Molecular Weight | 591.16 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | 2-chloro-6-(2,3-dihydro-1H-inden-4-ylamino)-4,5-dimethylpyridine-3-carbonitrile;6-N-(2,3-dihydro-1H-inden-4-yl)-4,5-dimethyl-2H-pyrazolo[3,4-b]pyridine-3,6-diamine |
| SMILES | Cc1c(Nc2cccc3c2CCC3)nc(Cl)c(C#N)c1C.Cc1c(Nc2cccc3c2CCC3)nc2n[nH]c(N)c2c1C |
| InChI | InChI=1S/C17H16ClN3.C17H19N5/c1-10-11(2)17(21-16(18)14(10)9-19)20-15-8-4-6-12-5-3-7-13(12)15;1-9-10(2)16(20-17-14(9)15(18)21-22-17)19-13-8-4-6-11-5-3-7-12(11)13/h4,6,8H,3,5,7H2,1-2H3,(H,20,21);4,6,8H,3,5,7H2,1-2H3,(H4,18,19,20,21,22) |
| InChIKey | SOLHTRLNZZCPSJ-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 128.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.16 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|