C18H20N4 — CID 59311734
8-(2-methylphenyl)-4,5,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),2,5,7-tetraen-3-amine (PubChem CID 59311734) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is 8-(2-methylphenyl)-4,5,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),2,5,7-tetraen-3-amine.
| Compound Name | 8-(2-methylphenyl)-4,5,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),2,5,7-tetraen-3-amine |
|---|---|
| PubChem CID | 59311734 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 8-(2-methylphenyl)-4,5,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),2,5,7-tetraen-3-amine |
| SMILES | Cc1ccccc1-c1nc2n[nH]c(N)c2c2c1CCCCC2 |
| InChI | InChI=1S/C18H20N4/c1-11-7-5-6-8-12(11)16-14-10-4-2-3-9-13(14)15-17(19)21-22-18(15)20-16/h5-8H,2-4,9-10H2,1H3,(H3,19,20,21,22) |
| InChIKey | QJJHGBWXLQZWHB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |