C19H14N6O2S — CID 16766844
12-amino-4-(ethylamino)-8-oxo-10-pyridin-3-yl-13-oxa-3-thia-7-azatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,11-tetraene-5,11-dicarbonitrile (PubChem CID 16766844) has the molecular formula C19H14N6O2S and a molecular weight of 390.43 g/mol. Its IUPAC name is 12-amino-4-(ethylamino)-8-oxo-10-pyridin-3-yl-13-oxa-3-thia-7-azatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,11-tetraene-5,11-dicarbonitrile.
| Compound Name | 12-amino-4-(ethylamino)-8-oxo-10-pyridin-3-yl-13-oxa-3-thia-7-azatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,11-tetraene-5,11-dicarbonitrile |
|---|---|
| PubChem CID | 16766844 |
| Molecular Formula | C19H14N6O2S |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 12-amino-4-(ethylamino)-8-oxo-10-pyridin-3-yl-13-oxa-3-thia-7-azatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,11-tetraene-5,11-dicarbonitrile |
| SMILES | CCNc1sc2c3c(c(=O)[nH]c2c1C#N)C(c1cccnc1)C(C#N)=C(N)O3 |
| InChI | InChI=1S/C19H14N6O2S/c1-2-24-19-11(7-21)14-16(28-19)15-13(18(26)25-14)12(9-4-3-5-23-8-9)10(6-20)17(22)27-15/h3-5,8,12,24H,2,22H2,1H3,(H,25,26) |
| InChIKey | JQAGEXVQBDSAAD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 140.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |