C20H14ClN5O2S — CID 26415370
(10S)-12-amino-10-(4-chlorophenyl)-4-(ethylamino)-8-oxo-13-oxa-3-thia-7-azatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,11-tetraene-5,11-dicarbonitrile (PubChem CID 26415370) has the molecular formula C20H14ClN5O2S and a molecular weight of 423.89 g/mol. Its IUPAC name is (10S)-12-amino-10-(4-chlorophenyl)-4-(ethylamino)-8-oxo-13-oxa-3-thia-7-azatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,11-tetraene-5,11-dicarbonitrile.
| Compound Name | (10S)-12-amino-10-(4-chlorophenyl)-4-(ethylamino)-8-oxo-13-oxa-3-thia-7-azatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,11-tetraene-5,11-dicarbonitrile |
|---|---|
| PubChem CID | 26415370 |
| Molecular Formula | C20H14ClN5O2S |
| Molecular Weight | 423.89 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | (10S)-12-amino-10-(4-chlorophenyl)-4-(ethylamino)-8-oxo-13-oxa-3-thia-7-azatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,11-tetraene-5,11-dicarbonitrile |
| SMILES | CCNc1sc2c3c(c(=O)[nH]c2c1C#N)[C@@H](c1ccc(Cl)cc1)C(C#N)=C(N)O3 |
| InChI | InChI=1S/C20H14ClN5O2S/c1-2-25-20-12(8-23)15-17(29-20)16-14(19(27)26-15)13(11(7-22)18(24)28-16)9-3-5-10(21)6-4-9/h3-6,13,25H,2,24H2,1H3,(H,26,27)/t13-/m0/s1 |
| InChIKey | AZYICYHOWNHNLP-ZDUSSCGKSA-N |
| XLogP | 3.76 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.89 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |