C30H29ClF2N2O4 — CID 167669044
(3-fluorophenyl)methanamine;N-[(3-fluorophenyl)methyl]-2-methoxybenzamide;2-methoxybenzoyl chloride (PubChem CID 167669044) has the molecular formula C30H29ClF2N2O4 and a molecular weight of 555.02 g/mol. Its IUPAC name is (3-fluorophenyl)methanamine;N-[(3-fluorophenyl)methyl]-2-methoxybenzamide;2-methoxybenzoyl chloride.
| Compound Name | (3-fluorophenyl)methanamine;N-[(3-fluorophenyl)methyl]-2-methoxybenzamide;2-methoxybenzoyl chloride |
|---|---|
| PubChem CID | 167669044 |
| Molecular Formula | C30H29ClF2N2O4 |
| Molecular Weight | 555.02 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | (3-fluorophenyl)methanamine;N-[(3-fluorophenyl)methyl]-2-methoxybenzamide;2-methoxybenzoyl chloride |
| SMILES | COc1ccccc1C(=O)Cl.COc1ccccc1C(=O)NCc1cccc(F)c1.NCc1cccc(F)c1 |
| InChI | InChI=1S/C15H14FNO2.C8H7ClO2.C7H8FN/c1-19-14-8-3-2-7-13(14)15(18)17-10-11-5-4-6-12(16)9-11;1-11-7-5-3-2-4-6(7)8(9)10;8-7-3-1-2-6(4-7)5-9/h2-9H,10H2,1H3,(H,17,18);2-5H,1H3;1-4H,5,9H2 |
| InChIKey | TVFJESKGKWPKRK-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.02 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|