C16H14FN3OS — CID 167673076
(3R)-N-(7-fluorobenzo[g][1,3]benzothiazol-2-yl)pyrrolidine-3-carboxamide (PubChem CID 167673076) has the molecular formula C16H14FN3OS and a molecular weight of 315.37 g/mol. Its IUPAC name is (3R)-N-(7-fluorobenzo[g][1,3]benzothiazol-2-yl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-(7-fluorobenzo[g][1,3]benzothiazol-2-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 167673076 |
| Molecular Formula | C16H14FN3OS |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | (3R)-N-(7-fluorobenzo[g][1,3]benzothiazol-2-yl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1nc2ccc3cc(F)ccc3c2s1)[C@@H]1CCNC1 |
| InChI | InChI=1S/C16H14FN3OS/c17-11-2-3-12-9(7-11)1-4-13-14(12)22-16(19-13)20-15(21)10-5-6-18-8-10/h1-4,7,10,18H,5-6,8H2,(H,19,20,21)/t10-/m1/s1 |
| InChIKey | UKJLOORAQGECMU-SNVBAGLBSA-N |
| XLogP | 3.14 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |