C18H20FN3O2S2 — CID 156743736
(2R)-N-(7-fluorobenzo[g][1,3]benzothiazol-2-yl)-2-(5-oxo-2-sulfanylpyrrolidin-2-yl)propanamide;molecular hydrogen (PubChem CID 156743736) has the molecular formula C18H20FN3O2S2 and a molecular weight of 393.51 g/mol. Its IUPAC name is (2R)-N-(7-fluorobenzo[g][1,3]benzothiazol-2-yl)-2-(5-oxo-2-sulfanylpyrrolidin-2-yl)propanamide;molecular hydrogen.
| Compound Name | (2R)-N-(7-fluorobenzo[g][1,3]benzothiazol-2-yl)-2-(5-oxo-2-sulfanylpyrrolidin-2-yl)propanamide;molecular hydrogen |
|---|---|
| PubChem CID | 156743736 |
| Molecular Formula | C18H20FN3O2S2 |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (2R)-N-(7-fluorobenzo[g][1,3]benzothiazol-2-yl)-2-(5-oxo-2-sulfanylpyrrolidin-2-yl)propanamide;molecular hydrogen |
| SMILES | C[C@H](C(=O)Nc1nc2ccc3cc(F)ccc3c2s1)C1(S)CCC(=O)N1.[H][H].[H][H] |
| InChI | InChI=1S/C18H16FN3O2S2.2H2/c1-9(18(25)7-6-14(23)22-18)16(24)21-17-20-13-5-2-10-8-11(19)3-4-12(10)15(13)26-17;;/h2-5,8-9,25H,6-7H2,1H3,(H,22,23)(H,20,21,24);2*1H/t9-,18?;;/m1../s1 |
| InChIKey | ZYCRSPPOESOJPL-KNEFLEGKSA-N |
| XLogP | 4.19 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|