C12H6CsFN2OS — CID 156743741
cesium [(7-fluorobenzo[g][1,3]benzothiazol-2-yl)amino]methanone (PubChem CID 156743741) has the molecular formula C12H6CsFN2OS and a molecular weight of 378.16 g/mol. Its IUPAC name is cesium [(7-fluorobenzo[g][1,3]benzothiazol-2-yl)amino]methanone.
| Compound Name | cesium [(7-fluorobenzo[g][1,3]benzothiazol-2-yl)amino]methanone |
|---|---|
| PubChem CID | 156743741 |
| Molecular Formula | C12H6CsFN2OS |
| Molecular Weight | 378.16 g/mol |
| Exact Mass | 377.92 |
| IUPAC Name | cesium [(7-fluorobenzo[g][1,3]benzothiazol-2-yl)amino]methanone |
| SMILES | O=[C-]Nc1nc2ccc3cc(F)ccc3c2s1.[Cs+] |
| InChI | InChI=1S/C12H6FN2OS.Cs/c13-8-2-3-9-7(5-8)1-4-10-11(9)17-12(15-10)14-6-16;/h1-5H,(H,14,15,16);/q-1;+1 |
| InChIKey | NYQRVHSVLUBGRG-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.16 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|