C25H37N5O3SSi — CID 167675678
tert-butyl 2-[3-[[5-(1,3,4-thiadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]acetate (PubChem CID 167675678) has the molecular formula C25H37N5O3SSi and a molecular weight of 515.76 g/mol. Its IUPAC name is tert-butyl 2-[3-[[5-(1,3,4-thiadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]acetate.
| Compound Name | tert-butyl 2-[3-[[5-(1,3,4-thiadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]acetate |
|---|---|
| PubChem CID | 167675678 |
| Molecular Formula | C25H37N5O3SSi |
| Molecular Weight | 515.76 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | tert-butyl 2-[3-[[5-(1,3,4-thiadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]amino]cyclobutyl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CC(Nc2c(-c3nncs3)cnc3c2ccn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C25H37N5O3SSi/c1-25(2,3)33-21(31)13-17-11-18(12-17)28-22-19-7-8-30(16-32-9-10-35(4,5)6)23(19)26-14-20(22)24-29-27-15-34-24/h7-8,14-15,17-18H,9-13,16H2,1-6H3,(H,26,28) |
| InChIKey | UTVHYCGBFXZASE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.76 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|