C26H37N5O3SSi — CID 140784002
tert-butyl N-[3-[3-(1,3,4-thiadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-en-1-yl]carbamate (PubChem CID 140784002) has the molecular formula C26H37N5O3SSi and a molecular weight of 527.77 g/mol. Its IUPAC name is tert-butyl N-[3-[3-(1,3,4-thiadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[3-[3-(1,3,4-thiadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 140784002 |
| Molecular Formula | C26H37N5O3SSi |
| Molecular Weight | 527.77 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | tert-butyl N-[3-[3-(1,3,4-thiadiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC=C(c2ccnc3c2c(-c2nncs2)cn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C26H37N5O3SSi/c1-26(2,3)34-25(32)29-19-9-7-8-18(14-19)20-10-11-27-23-22(20)21(24-30-28-16-35-24)15-31(23)17-33-12-13-36(4,5)6/h8,10-11,15-16,19H,7,9,12-14,17H2,1-6H3,(H,29,32) |
| InChIKey | CNCLYPZGACOPOD-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.77 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|