C8H16N4S — CID 16767729
3-(diethylamino)-4-ethyl-1H-1,2,4-triazole-5-thione (PubChem CID 16767729) has the molecular formula C8H16N4S and a molecular weight of 200.31 g/mol. Its IUPAC name is 3-(diethylamino)-4-ethyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(diethylamino)-4-ethyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 16767729 |
| Molecular Formula | C8H16N4S |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 3-(diethylamino)-4-ethyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCN(CC)c1n[nH]c(=S)n1CC |
| InChI | InChI=1S/C8H16N4S/c1-4-11(5-2)7-9-10-8(13)12(7)6-3/h4-6H2,1-3H3,(H,10,13) |
| InChIKey | NESMIWBFNBACKC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|