C9H15F3N4S — CID 55008735
4-ethyl-3-[propyl(2,2,2-trifluoroethyl)amino]-1H-1,2,4-triazole-5-thione (PubChem CID 55008735) has the molecular formula C9H15F3N4S and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-ethyl-3-[propyl(2,2,2-trifluoroethyl)amino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-ethyl-3-[propyl(2,2,2-trifluoroethyl)amino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 55008735 |
| Molecular Formula | C9H15F3N4S |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-ethyl-3-[propyl(2,2,2-trifluoroethyl)amino]-1H-1,2,4-triazole-5-thione |
| SMILES | CCCN(CC(F)(F)F)c1n[nH]c(=S)n1CC |
| InChI | InChI=1S/C9H15F3N4S/c1-3-5-15(6-9(10,11)12)7-13-14-8(17)16(7)4-2/h3-6H2,1-2H3,(H,14,17) |
| InChIKey | XYRDLDBJCKDQCE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|