C13H26N4S — CID 79483402
4-ethyl-3-[2-methylpropyl(pentan-3-yl)amino]-1H-1,2,4-triazole-5-thione (PubChem CID 79483402) has the molecular formula C13H26N4S and a molecular weight of 270.45 g/mol. Its IUPAC name is 4-ethyl-3-[2-methylpropyl(pentan-3-yl)amino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-ethyl-3-[2-methylpropyl(pentan-3-yl)amino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 79483402 |
| Molecular Formula | C13H26N4S |
| Molecular Weight | 270.45 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 4-ethyl-3-[2-methylpropyl(pentan-3-yl)amino]-1H-1,2,4-triazole-5-thione |
| SMILES | CCC(CC)N(CC(C)C)c1n[nH]c(=S)n1CC |
| InChI | InChI=1S/C13H26N4S/c1-6-11(7-2)17(9-10(4)5)12-14-15-13(18)16(12)8-3/h10-11H,6-9H2,1-5H3,(H,15,18) |
| InChIKey | PJEATMDNDOLWFD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|