C28H40F2O8S — CID 167681089
[(3S,4S,5R,6R)-2-acetyloxy-6-ethyl-4-fluoro-5-methyloxan-3-yl] acetate;[(2S,3R,4S,5R,6R)-6-ethyl-4-fluoro-5-methyl-2-phenylsulfanyloxan-3-yl] acetate (PubChem CID 167681089) has the molecular formula C28H40F2O8S and a molecular weight of 574.68 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-2-acetyloxy-6-ethyl-4-fluoro-5-methyloxan-3-yl] acetate;[(2S,3R,4S,5R,6R)-6-ethyl-4-fluoro-5-methyl-2-phenylsulfanyloxan-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6R)-2-acetyloxy-6-ethyl-4-fluoro-5-methyloxan-3-yl] acetate;[(2S,3R,4S,5R,6R)-6-ethyl-4-fluoro-5-methyl-2-phenylsulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 167681089 |
| Molecular Formula | C28H40F2O8S |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | [(3S,4S,5R,6R)-2-acetyloxy-6-ethyl-4-fluoro-5-methyloxan-3-yl] acetate;[(2S,3R,4S,5R,6R)-6-ethyl-4-fluoro-5-methyl-2-phenylsulfanyloxan-3-yl] acetate |
| SMILES | CC[C@H]1OC(OC(C)=O)[C@H](OC(C)=O)[C@@H](F)[C@@H]1C.CC[C@H]1O[C@@H](Sc2ccccc2)[C@H](OC(C)=O)[C@@H](F)[C@@H]1C |
| InChI | InChI=1S/C16H21FO3S.C12H19FO5/c1-4-13-10(2)14(17)15(19-11(3)18)16(20-13)21-12-8-6-5-7-9-12;1-5-9-6(2)10(13)11(16-7(3)14)12(18-9)17-8(4)15/h5-10,13-16H,4H2,1-3H3;6,9-12H,5H2,1-4H3/t10-,13-,14+,15-,16+;6-,9-,10+,11-,12?/m11/s1 |
| InChIKey | VNYZWKUYQHBOMS-OHVDKNLESA-N |
| XLogP | 5.41 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|