C23H27NO7S — CID 167681469
cyclohexyloxycarbonyloxymethyl 3-[(2,5-dimethylphenyl)sulfamoyl]benzoate (PubChem CID 167681469) has the molecular formula C23H27NO7S and a molecular weight of 461.54 g/mol. Its IUPAC name is cyclohexyloxycarbonyloxymethyl 3-[(2,5-dimethylphenyl)sulfamoyl]benzoate.
| Compound Name | cyclohexyloxycarbonyloxymethyl 3-[(2,5-dimethylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 167681469 |
| Molecular Formula | C23H27NO7S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | cyclohexyloxycarbonyloxymethyl 3-[(2,5-dimethylphenyl)sulfamoyl]benzoate |
| SMILES | Cc1ccc(C)c(NS(=O)(=O)c2cccc(C(=O)OCOC(=O)OC3CCCCC3)c2)c1 |
| InChI | InChI=1S/C23H27NO7S/c1-16-11-12-17(2)21(13-16)24-32(27,28)20-10-6-7-18(14-20)22(25)29-15-30-23(26)31-19-8-4-3-5-9-19/h6-7,10-14,19,24H,3-5,8-9,15H2,1-2H3 |
| InChIKey | VPIUVHMVGCAGAF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|