C7H14N4OS — CID 16768185
3-(dimethylamino)-4-(2-methoxyethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 16768185) has the molecular formula C7H14N4OS and a molecular weight of 202.28 g/mol. Its IUPAC name is 3-(dimethylamino)-4-(2-methoxyethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(dimethylamino)-4-(2-methoxyethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 16768185 |
| Molecular Formula | C7H14N4OS |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 3-(dimethylamino)-4-(2-methoxyethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | COCCn1c(N(C)C)n[nH]c1=S |
| InChI | InChI=1S/C7H14N4OS/c1-10(2)6-8-9-7(13)11(6)4-5-12-3/h4-5H2,1-3H3,(H,9,13) |
| InChIKey | ZFANGPMGRXJEFU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 46.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|