C16H14F3NO5S — CID 16768581
5-(dimethylsulfamoyl)-2-[2-(trifluoromethoxy)phenyl]benzoic acid (PubChem CID 16768581) has the molecular formula C16H14F3NO5S and a molecular weight of 389.35 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-2-[2-(trifluoromethoxy)phenyl]benzoic acid.
| Compound Name | 5-(dimethylsulfamoyl)-2-[2-(trifluoromethoxy)phenyl]benzoic acid |
|---|---|
| PubChem CID | 16768581 |
| Molecular Formula | C16H14F3NO5S |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 5-(dimethylsulfamoyl)-2-[2-(trifluoromethoxy)phenyl]benzoic acid |
| SMILES | CN(C)S(=O)(=O)c1ccc(-c2ccccc2OC(F)(F)F)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H14F3NO5S/c1-20(2)26(23,24)10-7-8-11(13(9-10)15(21)22)12-5-3-4-6-14(12)25-16(17,18)19/h3-9H,1-2H3,(H,21,22) |
| InChIKey | XYHQLPDIKCNAJW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |