C28H25N5O — CID 167690149
2-(4-methylphenyl)-3H-benzimidazol-5-amine;2-(4-methylphenyl)-1,3-benzoxazol-5-amine (PubChem CID 167690149) has the molecular formula C28H25N5O and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-(4-methylphenyl)-3H-benzimidazol-5-amine;2-(4-methylphenyl)-1,3-benzoxazol-5-amine.
| Compound Name | 2-(4-methylphenyl)-3H-benzimidazol-5-amine;2-(4-methylphenyl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 167690149 |
| Molecular Formula | C28H25N5O |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 2-(4-methylphenyl)-3H-benzimidazol-5-amine;2-(4-methylphenyl)-1,3-benzoxazol-5-amine |
| SMILES | Cc1ccc(-c2nc3cc(N)ccc3o2)cc1.Cc1ccc(-c2nc3ccc(N)cc3[nH]2)cc1 |
| InChI | InChI=1S/C14H13N3.C14H12N2O/c1-9-2-4-10(5-3-9)14-16-12-7-6-11(15)8-13(12)17-14;1-9-2-4-10(5-3-9)14-16-12-8-11(15)6-7-13(12)17-14/h2-8H,15H2,1H3,(H,16,17);2-8H,15H2,1H3 |
| InChIKey | WUPLYXJPFCLGIX-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 106.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|