C15H13N4O+ — CID 4048122
2-(2-methyl-3H-benzimidazol-1-ium-5-yl)-1,3-benzoxazol-5-amine (PubChem CID 4048122) has the molecular formula C15H13N4O+ and a molecular weight of 265.30 g/mol. Its IUPAC name is 2-(2-methyl-3H-benzimidazol-1-ium-5-yl)-1,3-benzoxazol-5-amine.
| Compound Name | 2-(2-methyl-3H-benzimidazol-1-ium-5-yl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 4048122 |
| Molecular Formula | C15H13N4O+ |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-(2-methyl-3H-benzimidazol-1-ium-5-yl)-1,3-benzoxazol-5-amine |
| SMILES | Cc1[nH]c2cc(-c3nc4cc(N)ccc4o3)ccc2[nH+]1 |
| InChI | InChI=1S/C15H12N4O/c1-8-17-11-4-2-9(6-12(11)18-8)15-19-13-7-10(16)3-5-14(13)20-15/h2-7H,16H2,1H3,(H,17,18)/p+1 |
| InChIKey | USMSCRUBPSZWRK-UHFFFAOYSA-O |
| XLogP | 2.68 |
| TPSA | 81.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|