C23H36N2S2 — CID 167694355
2-tert-butyl-1H-imidazole;2-tert-butylthiophene;3-tert-butylthiophene (PubChem CID 167694355) has the molecular formula C23H36N2S2 and a molecular weight of 404.69 g/mol. Its IUPAC name is 2-tert-butyl-1H-imidazole;2-tert-butylthiophene;3-tert-butylthiophene.
| Compound Name | 2-tert-butyl-1H-imidazole;2-tert-butylthiophene;3-tert-butylthiophene |
|---|---|
| PubChem CID | 167694355 |
| Molecular Formula | C23H36N2S2 |
| Molecular Weight | 404.69 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 2-tert-butyl-1H-imidazole;2-tert-butylthiophene;3-tert-butylthiophene |
| SMILES | CC(C)(C)c1cccs1.CC(C)(C)c1ccsc1.CC(C)(C)c1ncc[nH]1 |
| InChI | InChI=1S/2C8H12S.C7H12N2/c1-8(2,3)7-4-5-9-6-7;1-8(2,3)7-5-4-6-9-7;1-7(2,3)6-8-4-5-9-6/h2*4-6H,1-3H3;4-5H,1-3H3,(H,8,9) |
| InChIKey | XKRXCMDDWPHSKS-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.69 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |