C28H28N6 — CID 167696040
7-[bis(6,7-dimethyl-2H-benzimidazol-4-yl)methyl]-4,5-dimethyl-2H-benzimidazole (PubChem CID 167696040) has the molecular formula C28H28N6 and a molecular weight of 448.57 g/mol. Its IUPAC name is 7-[bis(6,7-dimethyl-2H-benzimidazol-4-yl)methyl]-4,5-dimethyl-2H-benzimidazole.
| Compound Name | 7-[bis(6,7-dimethyl-2H-benzimidazol-4-yl)methyl]-4,5-dimethyl-2H-benzimidazole |
|---|---|
| PubChem CID | 167696040 |
| Molecular Formula | C28H28N6 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 7-[bis(6,7-dimethyl-2H-benzimidazol-4-yl)methyl]-4,5-dimethyl-2H-benzimidazole |
| SMILES | Cc1cc(C(c2cc(C)c(C)c3c2=NCN=3)c2cc(C)c(C)c3c2=NCN=3)c2c(c1C)=NCN=2 |
| InChI | InChI=1S/C28H28N6/c1-13-7-19(26-23(16(13)4)29-10-32-26)22(20-8-14(2)17(5)24-27(20)33-11-30-24)21-9-15(3)18(6)25-28(21)34-12-31-25/h7-9,22H,10-12H2,1-6H3 |
| InChIKey | NTOOEPIPHGFPMX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 74.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|