C20H33N4O10P — CID 167699547
[methoxy-[[(2R)-1-(6-methylpurin-9-yl)propan-2-yl]oxymethyl]phosphoryl]oxymethyl propan-2-yl carbonate;propan-2-yl hydrogen carbonate (PubChem CID 167699547) has the molecular formula C20H33N4O10P and a molecular weight of 520.48 g/mol. Its IUPAC name is [methoxy-[[(2R)-1-(6-methylpurin-9-yl)propan-2-yl]oxymethyl]phosphoryl]oxymethyl propan-2-yl carbonate;propan-2-yl hydrogen carbonate.
| Compound Name | [methoxy-[[(2R)-1-(6-methylpurin-9-yl)propan-2-yl]oxymethyl]phosphoryl]oxymethyl propan-2-yl carbonate;propan-2-yl hydrogen carbonate |
|---|---|
| PubChem CID | 167699547 |
| Molecular Formula | C20H33N4O10P |
| Molecular Weight | 520.48 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | [methoxy-[[(2R)-1-(6-methylpurin-9-yl)propan-2-yl]oxymethyl]phosphoryl]oxymethyl propan-2-yl carbonate;propan-2-yl hydrogen carbonate |
| SMILES | CC(C)OC(=O)O.COP(=O)(CO[C@H](C)Cn1cnc2c(C)ncnc21)OCOC(=O)OC(C)C |
| InChI | InChI=1S/C16H25N4O7P.C4H8O3/c1-11(2)27-16(21)24-9-26-28(22,23-5)10-25-12(3)6-20-8-19-14-13(4)17-7-18-15(14)20;1-3(2)7-4(5)6/h7-8,11-12H,6,9-10H2,1-5H3;3H,1-2H3,(H,5,6)/t12-,28?;/m1./s1 |
| InChIKey | YDZHQEHMXLEUII-PNOPVXOPSA-N |
| XLogP | 3.96 |
| TPSA | 170.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|