C30H34FN3O3 — CID 167709003
1-[2-cyclobutyl-5-[4-(4-ethynylphenyl)-4-fluoropiperidine-1-carbonyl]-4-methylphenyl]-3-[(3S)-oxolan-3-yl]urea (PubChem CID 167709003) has the molecular formula C30H34FN3O3 and a molecular weight of 503.62 g/mol. Its IUPAC name is 1-[2-cyclobutyl-5-[4-(4-ethynylphenyl)-4-fluoropiperidine-1-carbonyl]-4-methylphenyl]-3-[(3S)-oxolan-3-yl]urea.
| Compound Name | 1-[2-cyclobutyl-5-[4-(4-ethynylphenyl)-4-fluoropiperidine-1-carbonyl]-4-methylphenyl]-3-[(3S)-oxolan-3-yl]urea |
|---|---|
| PubChem CID | 167709003 |
| Molecular Formula | C30H34FN3O3 |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | 1-[2-cyclobutyl-5-[4-(4-ethynylphenyl)-4-fluoropiperidine-1-carbonyl]-4-methylphenyl]-3-[(3S)-oxolan-3-yl]urea |
| SMILES | C#Cc1ccc(C2(F)CCN(C(=O)c3cc(NC(=O)N[C@H]4CCOC4)c(C4CCC4)cc3C)CC2)cc1 |
| InChI | InChI=1S/C30H34FN3O3/c1-3-21-7-9-23(10-8-21)30(31)12-14-34(15-13-30)28(35)25-18-27(26(17-20(25)2)22-5-4-6-22)33-29(36)32-24-11-16-37-19-24/h1,7-10,17-18,22,24H,4-6,11-16,19H2,2H3,(H2,32,33,36)/t24-/m0/s1 |
| InChIKey | XDOLBINFGBBTTR-DEOSSOPVSA-N |
| XLogP | 5.26 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|