C19H27NO3 — CID 167711510
benzyl (2S,4S)-1-methyl-4-(oxan-4-ylmethyl)pyrrolidine-2-carboxylate (PubChem CID 167711510) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is benzyl (2S,4S)-1-methyl-4-(oxan-4-ylmethyl)pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S,4S)-1-methyl-4-(oxan-4-ylmethyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 167711510 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | benzyl (2S,4S)-1-methyl-4-(oxan-4-ylmethyl)pyrrolidine-2-carboxylate |
| SMILES | CN1C[C@@H](CC2CCOCC2)C[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H27NO3/c1-20-13-17(11-15-7-9-22-10-8-15)12-18(20)19(21)23-14-16-5-3-2-4-6-16/h2-6,15,17-18H,7-14H2,1H3/t17-,18-/m0/s1 |
| InChIKey | QAZNPJKFSVNGSO-ROUUACIJSA-N |
| XLogP | 2.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |