C32H29NO5 — CID 167713832
4,6,8-tris(2-methoxyphenyl)-2,2-dimethyl-5H-[1,3]dioxolo[4,5-f]indole (PubChem CID 167713832) has the molecular formula C32H29NO5 and a molecular weight of 507.59 g/mol. Its IUPAC name is 4,6,8-tris(2-methoxyphenyl)-2,2-dimethyl-5H-[1,3]dioxolo[4,5-f]indole.
| Compound Name | 4,6,8-tris(2-methoxyphenyl)-2,2-dimethyl-5H-[1,3]dioxolo[4,5-f]indole |
|---|---|
| PubChem CID | 167713832 |
| Molecular Formula | C32H29NO5 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 4,6,8-tris(2-methoxyphenyl)-2,2-dimethyl-5H-[1,3]dioxolo[4,5-f]indole |
| SMILES | COc1ccccc1-c1cc2c(-c3ccccc3OC)c3c(c(-c4ccccc4OC)c2[nH]1)OC(C)(C)O3 |
| InChI | InChI=1S/C32H29NO5/c1-32(2)37-30-27(20-13-7-10-16-25(20)35-4)22-18-23(19-12-6-9-15-24(19)34-3)33-29(22)28(31(30)38-32)21-14-8-11-17-26(21)36-5/h6-18,33H,1-5H3 |
| InChIKey | SIZXEVIIRQBHQX-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 61.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |