C19H12N6O5 — CID 167713895
6-amino-1-(2,4-dinitrophenyl)-4-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 167713895) has the molecular formula C19H12N6O5 and a molecular weight of 404.34 g/mol. Its IUPAC name is 6-amino-1-(2,4-dinitrophenyl)-4-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-1-(2,4-dinitrophenyl)-4-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 167713895 |
| Molecular Formula | C19H12N6O5 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 6-amino-1-(2,4-dinitrophenyl)-4-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(cnn2-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C1c1ccccc1 |
| InChI | InChI=1S/C19H12N6O5/c20-9-13-17(11-4-2-1-3-5-11)14-10-22-23(19(14)30-18(13)21)15-7-6-12(24(26)27)8-16(15)25(28)29/h1-8,10,17H,21H2 |
| InChIKey | IRQRSVKWDDPKIQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 163.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|