C22H24N4O4S — CID 167716289
2-(2,6-dioxopiperidin-3-yl)-4-[[[(1R)-3-(methylamino)-1-thiophen-2-ylpropyl]amino]methyl]isoindole-1,3-dione (PubChem CID 167716289) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[[[(1R)-3-(methylamino)-1-thiophen-2-ylpropyl]amino]methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[[(1R)-3-(methylamino)-1-thiophen-2-ylpropyl]amino]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167716289 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[[[(1R)-3-(methylamino)-1-thiophen-2-ylpropyl]amino]methyl]isoindole-1,3-dione |
| SMILES | CNCC[C@@H](NCc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)c1cccs1 |
| InChI | InChI=1S/C22H24N4O4S/c1-23-10-9-15(17-6-3-11-31-17)24-12-13-4-2-5-14-19(13)22(30)26(21(14)29)16-7-8-18(27)25-20(16)28/h2-6,11,15-16,23-24H,7-10,12H2,1H3,(H,25,27,28)/t15-,16?/m1/s1 |
| InChIKey | KVSLWHWMJPOGRX-AAFJCEBUSA-N |
| XLogP | 1.59 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|