C22H26N4O3S — CID 167725252
3-[4-[[[(1R)-3-(methylamino)-1-thiophen-2-ylpropyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167725252) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 3-[4-[[[(1R)-3-(methylamino)-1-thiophen-2-ylpropyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[[[(1R)-3-(methylamino)-1-thiophen-2-ylpropyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167725252 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 3-[4-[[[(1R)-3-(methylamino)-1-thiophen-2-ylpropyl]amino]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CNCC[C@@H](NCc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2)c1cccs1 |
| InChI | InChI=1S/C22H26N4O3S/c1-23-10-9-16(18-6-3-11-30-18)24-12-14-4-2-5-15-13-26(22(29)20(14)15)17-7-8-19(27)25-21(17)28/h2-6,11,16-17,23-24H,7-10,12-13H2,1H3,(H,25,27,28)/t16-,17?/m1/s1 |
| InChIKey | NBXOSWQMDWNUEI-TZHYSIJRSA-N |
| XLogP | 1.95 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|