C26H28N4O4 — CID 167717593
5-[[benzyl(piperidin-3-yl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167717593) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is 5-[[benzyl(piperidin-3-yl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[benzyl(piperidin-3-yl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167717593 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 5-[[benzyl(piperidin-3-yl)amino]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(CN(Cc4ccccc4)C4CCCNC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H28N4O4/c31-23-11-10-22(24(32)28-23)30-25(33)20-9-8-18(13-21(20)26(30)34)16-29(19-7-4-12-27-14-19)15-17-5-2-1-3-6-17/h1-3,5-6,8-9,13,19,22,27H,4,7,10-12,14-16H2,(H,28,31,32) |
| InChIKey | RIAZBRSQUUYZHS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|