C10H15NO — CID 167718207
(3aS,6aR)-spiro[2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5,3'-cyclobutane]-1'-one (PubChem CID 167718207) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is (3aS,6aR)-spiro[2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5,3'-cyclobutane]-1'-one.
| Compound Name | (3aS,6aR)-spiro[2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5,3'-cyclobutane]-1'-one |
|---|---|
| PubChem CID | 167718207 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (3aS,6aR)-spiro[2,3,3a,4,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-5,3'-cyclobutane]-1'-one |
| SMILES | O=C1CC2(C1)C[C@H]1CNC[C@H]1C2 |
| InChI | InChI=1S/C10H15NO/c12-9-3-10(4-9)1-7-5-11-6-8(7)2-10/h7-8,11H,1-6H2/t7-,8+ |
| InChIKey | MLTLRHDDXIWITN-OCAPTIKFSA-N |
| XLogP | 0.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |