C11H14ClN3 — CID 167724461
1-(2,5-dimethylphenyl)pyrazol-3-amine;hydrochloride (PubChem CID 167724461) has the molecular formula C11H14ClN3 and a molecular weight of 223.71 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)pyrazol-3-amine;hydrochloride.
| Compound Name | 1-(2,5-dimethylphenyl)pyrazol-3-amine;hydrochloride |
|---|---|
| PubChem CID | 167724461 |
| Molecular Formula | C11H14ClN3 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 1-(2,5-dimethylphenyl)pyrazol-3-amine;hydrochloride |
| SMILES | Cc1ccc(C)c(-n2ccc(N)n2)c1.Cl |
| InChI | InChI=1S/C11H13N3.ClH/c1-8-3-4-9(2)10(7-8)14-6-5-11(12)13-14;/h3-7H,1-2H3,(H2,12,13);1H |
| InChIKey | VYTDWRSSESKRNJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |